Other Solvents
Filtered Search Results
3,4-Dimethyldiphenylamine 98.0+%, TCI America™
CAS: 17802-36-7 Molecular Formula: C14H15N Molecular Weight (g/mol): 197.281 MDL Number: MFCD03093248 InChI Key: ACWJKFBBRPYPLL-UHFFFAOYSA-N Synonym: N-Phenyl-3,4-xylidine, Phenyl(3,4-xylyl)amine PubChem CID: 14958605 IUPAC Name: 3,4-dimethyl-N-phenylaniline SMILES: CC1=C(C=C(C=C1)NC2=CC=CC=C2)C
| PubChem CID | 14958605 |
|---|---|
| CAS | 17802-36-7 |
| Molecular Weight (g/mol) | 197.281 |
| MDL Number | MFCD03093248 |
| SMILES | CC1=C(C=C(C=C1)NC2=CC=CC=C2)C |
| Synonym | N-Phenyl-3,4-xylidine, Phenyl(3,4-xylyl)amine |
| IUPAC Name | 3,4-dimethyl-N-phenylaniline |
| InChI Key | ACWJKFBBRPYPLL-UHFFFAOYSA-N |
| Molecular Formula | C14H15N |
2,3-Dimethylphenylboronic Acid (contains varying amounts of Anhydride), TCI America™
CAS: 183158-34-1 Molecular Formula: C8H11BO2 Molecular Weight (g/mol): 149.984 MDL Number: MFCD01863524 InChI Key: ZYYANAWVBDFAHY-UHFFFAOYSA-N Synonym: 2,3-dimethylbenzeneboronic acid,2,3-dimethylphenyl boronic acid,o-xylene-3-boronic acid,2,3-dimethylphenyl boranediol,2,3-dimethylbenzeneboronicacid,2,3-dimethylphenylboronicacid,pubchem5037,acmc-1bxk2,amtb394,ksc174k9l PubChem CID: 2773395 IUPAC Name: (2,3-dimethylphenyl)boronic acid SMILES: B(C1=C(C(=CC=C1)C)C)(O)O
| PubChem CID | 2773395 |
|---|---|
| CAS | 183158-34-1 |
| Molecular Weight (g/mol) | 149.984 |
| MDL Number | MFCD01863524 |
| SMILES | B(C1=C(C(=CC=C1)C)C)(O)O |
| Synonym | 2,3-dimethylbenzeneboronic acid,2,3-dimethylphenyl boronic acid,o-xylene-3-boronic acid,2,3-dimethylphenyl boranediol,2,3-dimethylbenzeneboronicacid,2,3-dimethylphenylboronicacid,pubchem5037,acmc-1bxk2,amtb394,ksc174k9l |
| IUPAC Name | (2,3-dimethylphenyl)boronic acid |
| InChI Key | ZYYANAWVBDFAHY-UHFFFAOYSA-N |
| Molecular Formula | C8H11BO2 |
2,5-Dimethylphenylboronic Acid (contains varying amounts of Anhydride), TCI America™
CAS: 85199-06-0 Molecular Formula: C8H11BO2 Molecular Weight (g/mol): 149.98 MDL Number: MFCD01863525 InChI Key: OOMZKLJLVGQZGV-UHFFFAOYSA-N Synonym: 2,5-dimethylphenyl boronic acid,2,5-dimethylbenzeneboronic acid,2,5-dimethylphenylboronicacid,2,5-dimethylphenyl boranediol,p-xylene-2-boronic acid,boronic acid, 2,5-dimethylphenyl,pubchem1831,p-xyleneboronic acid,ksc448a1r,2,5-dimehylphenylboronic acid PubChem CID: 2734347 IUPAC Name: (2,5-dimethylphenyl)boronic acid SMILES: CC1=CC=C(C)C(=C1)B(O)O
| PubChem CID | 2734347 |
|---|---|
| CAS | 85199-06-0 |
| Molecular Weight (g/mol) | 149.98 |
| MDL Number | MFCD01863525 |
| SMILES | CC1=CC=C(C)C(=C1)B(O)O |
| Synonym | 2,5-dimethylphenyl boronic acid,2,5-dimethylbenzeneboronic acid,2,5-dimethylphenylboronicacid,2,5-dimethylphenyl boranediol,p-xylene-2-boronic acid,boronic acid, 2,5-dimethylphenyl,pubchem1831,p-xyleneboronic acid,ksc448a1r,2,5-dimehylphenylboronic acid |
| IUPAC Name | (2,5-dimethylphenyl)boronic acid |
| InChI Key | OOMZKLJLVGQZGV-UHFFFAOYSA-N |
| Molecular Formula | C8H11BO2 |
2-(3,5-Dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 97.0+%, TCI America™
CAS: 325142-93-6 Molecular Formula: C14H21BO2 Molecular Weight (g/mol): 232.13 InChI Key: XWCNEQGQJTWRHX-UHFFFAOYSA-N Synonym: 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-m-xylene, 3,5-Dimethylphenylboronic Acid Pinacol Ester PubChem CID: 15906198 IUPAC Name: 2-(3,5-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane SMILES: B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)C)C
| PubChem CID | 15906198 |
|---|---|
| CAS | 325142-93-6 |
| Molecular Weight (g/mol) | 232.13 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)C)C |
| Synonym | 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-m-xylene, 3,5-Dimethylphenylboronic Acid Pinacol Ester |
| IUPAC Name | 2-(3,5-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChI Key | XWCNEQGQJTWRHX-UHFFFAOYSA-N |
| Molecular Formula | C14H21BO2 |
2-(3-Chlorophenyl)ethanol 98.0+%, TCI America™
CAS: 5182-44-5 Molecular Formula: C8H9ClO Molecular Weight (g/mol): 156.61 MDL Number: MFCD00002892 InChI Key: NDWAVJKRSASRPH-UHFFFAOYSA-N Synonym: 2-3-chlorophenyl ethanol,3-chlorophenethyl alcohol,benzeneethanol, 3-chloro,3-chlorophenethylalcohol,2-3-chlorophenyl ethan-1-ol,m-chlorophenethyl alcohol,m-chlorophenethylic alcohol,phenethyl alcohol, m-chloro,3-chlorobenzeneethanol,acmc-1cuee PubChem CID: 78856 IUPAC Name: 2-(3-chlorophenyl)ethan-1-ol SMILES: OCCC1=CC=CC(Cl)=C1
| PubChem CID | 78856 |
|---|---|
| CAS | 5182-44-5 |
| Molecular Weight (g/mol) | 156.61 |
| MDL Number | MFCD00002892 |
| SMILES | OCCC1=CC=CC(Cl)=C1 |
| Synonym | 2-3-chlorophenyl ethanol,3-chlorophenethyl alcohol,benzeneethanol, 3-chloro,3-chlorophenethylalcohol,2-3-chlorophenyl ethan-1-ol,m-chlorophenethyl alcohol,m-chlorophenethylic alcohol,phenethyl alcohol, m-chloro,3-chlorobenzeneethanol,acmc-1cuee |
| IUPAC Name | 2-(3-chlorophenyl)ethan-1-ol |
| InChI Key | NDWAVJKRSASRPH-UHFFFAOYSA-N |
| Molecular Formula | C8H9ClO |
| PubChem CID | 16217512 |
|---|---|
| CAS | 357611-51-9 |
| MDL Number | MFCD05865178 |
| Physical Form | Crystal-Powder at 20°C |
| TSCA | No |
| IUPAC Name | (3,5-dimethyl-4-propoxyphenyl)boronic acid |
| InChI Key | ISUPZUFVQLUFLM-UHFFFAOYSA-N |
| Molecular Formula | C11H17BO3 |
| Formula Weight | 208.06 |
2-Amino-5-chlorobenzonitrile 98.0+%, TCI America™
CAS: 5922-60-1 Molecular Formula: C7H5ClN2 Molecular Weight (g/mol): 152.58 MDL Number: MFCD00017106 InChI Key: QYRDWARBHMCOAG-UHFFFAOYSA-N Synonym: 5-chloroanthranilonitrile,benzonitrile, 2-amino-5-chloro,anthranilonitrile, 5-chloro,2-amino-5-chloro-benzonitrile,4-chloro-2-cyanoaniline,unii-gy0x0082qb,2-amino-5-chloro benzonitrile,amino 2-5-chloro-benzonitrile,2-amino-5-chlorobenzenecarbonitrile,acbn PubChem CID: 80019 IUPAC Name: 2-amino-5-chlorobenzonitrile SMILES: NC1=CC=C(Cl)C=C1C#N
| PubChem CID | 80019 |
|---|---|
| CAS | 5922-60-1 |
| Molecular Weight (g/mol) | 152.58 |
| MDL Number | MFCD00017106 |
| SMILES | NC1=CC=C(Cl)C=C1C#N |
| Synonym | 5-chloroanthranilonitrile,benzonitrile, 2-amino-5-chloro,anthranilonitrile, 5-chloro,2-amino-5-chloro-benzonitrile,4-chloro-2-cyanoaniline,unii-gy0x0082qb,2-amino-5-chloro benzonitrile,amino 2-5-chloro-benzonitrile,2-amino-5-chlorobenzenecarbonitrile,acbn |
| IUPAC Name | 2-amino-5-chlorobenzonitrile |
| InChI Key | QYRDWARBHMCOAG-UHFFFAOYSA-N |
| Molecular Formula | C7H5ClN2 |
Potassium Tetrakis(4-chlorophenyl)borate 98.0+%, TCI America™
CAS: 14680-77-4 Molecular Formula: C24H16BCl4K Molecular Weight (g/mol): 496.10 MDL Number: MFCD00043105 InChI Key: VHPYLDPFVZBNQT-UHFFFAOYSA-N Synonym: potassium tetrakis 4-chlorophenyl borate,tetrakis 4-chlorophenyl boron potassium,k-tcpb,potassium tetrakis 4-chlorophenyl boranuide,potassium tetrakis 4-chlorophenyl borate, selectophore tm PubChem CID: 23679691 IUPAC Name: boron(3+) potassium tetrakis(3-chlorobenzen-1-ide) SMILES: [B+3].[K+].ClC1=CC=C[C-]=C1.ClC1=CC=C[C-]=C1.ClC1=CC=C[C-]=C1.ClC1=CC=C[C-]=C1
| PubChem CID | 23679691 |
|---|---|
| CAS | 14680-77-4 |
| Molecular Weight (g/mol) | 496.10 |
| MDL Number | MFCD00043105 |
| SMILES | [B+3].[K+].ClC1=CC=C[C-]=C1.ClC1=CC=C[C-]=C1.ClC1=CC=C[C-]=C1.ClC1=CC=C[C-]=C1 |
| Synonym | potassium tetrakis 4-chlorophenyl borate,tetrakis 4-chlorophenyl boron potassium,k-tcpb,potassium tetrakis 4-chlorophenyl boranuide,potassium tetrakis 4-chlorophenyl borate, selectophore tm |
| IUPAC Name | boron(3+) potassium tetrakis(3-chlorobenzen-1-ide) |
| InChI Key | VHPYLDPFVZBNQT-UHFFFAOYSA-N |
| Molecular Formula | C24H16BCl4K |
TMS-HT (=HMDS and TMCS in Anhydrous Pyridine) [for Gas Chromatography], TCI America™
MDL Number: MFCD00192427 Synonym: Hexamethyldisilazane and Trimethylchlorosilane in Anhydrous Pyridine, Trimethylchlorosilane and Hexamethyldisilazane in Anhydrous Pyridine
| MDL Number | MFCD00192427 |
|---|---|
| Synonym | Hexamethyldisilazane and Trimethylchlorosilane in Anhydrous Pyridine, Trimethylchlorosilane and Hexamethyldisilazane in Anhydrous Pyridine |
3'-Amino-4'-chloroacetanilide 98.0+%, TCI America™
CAS: 51867-83-5 Molecular Formula: C8H9ClN2O Molecular Weight (g/mol): 184.623 MDL Number: MFCD02093411 InChI Key: MIIPQGGYCFVDAI-UHFFFAOYSA-N Synonym: n-3-amino-4-chlorophenyl acetamide,3'-amino-4'-chloroacetanilide,5-acetylamido-2-chloroaniline,3-amino-4-chloroacetanilide,n-3-amino-4-chloro-phenyl acetamide,n-3-amino-4-chlorphenyl acetamid,acetamide, n-3-amino-4-chlorophenyl,n-3-azanyl-4-chloranyl-phenyl ethanamide,acmc-209kwg,ksc595a1f PubChem CID: 103996 ChEBI: CHEBI:86568 IUPAC Name: N-(3-amino-4-chlorophenyl)acetamide SMILES: CC(=O)NC1=CC(=C(C=C1)Cl)N
| PubChem CID | 103996 |
|---|---|
| CAS | 51867-83-5 |
| Molecular Weight (g/mol) | 184.623 |
| ChEBI | CHEBI:86568 |
| MDL Number | MFCD02093411 |
| SMILES | CC(=O)NC1=CC(=C(C=C1)Cl)N |
| Synonym | n-3-amino-4-chlorophenyl acetamide,3'-amino-4'-chloroacetanilide,5-acetylamido-2-chloroaniline,3-amino-4-chloroacetanilide,n-3-amino-4-chloro-phenyl acetamide,n-3-amino-4-chlorphenyl acetamid,acetamide, n-3-amino-4-chlorophenyl,n-3-azanyl-4-chloranyl-phenyl ethanamide,acmc-209kwg,ksc595a1f |
| IUPAC Name | N-(3-amino-4-chlorophenyl)acetamide |
| InChI Key | MIIPQGGYCFVDAI-UHFFFAOYSA-N |
| Molecular Formula | C8H9ClN2O |
2-Ethyl-p-xylene 98.0+%, TCI America™
CAS: 1758-88-9 Molecular Formula: C10H14 Molecular Weight (g/mol): 134.222 MDL Number: MFCD00059233 InChI Key: AXIUBBVSOWPLDA-UHFFFAOYSA-N Synonym: 2-ethyl-p-xylene,1,4-dimethyl-2-ethylbenzene,benzene, 2-ethyl-1,4-dimethyl,2,5-dimethylethylbenzene,p-xylene, 2-ethyl,1-ethyl-2,5-dimethylbenzene,1,4-dimethyl-2-ethyl benzene,acmc-1c122,p-xylene, 2-ethyl-8ci PubChem CID: 15653 IUPAC Name: 2-ethyl-1,4-dimethylbenzene SMILES: CCC1=C(C=CC(=C1)C)C
| PubChem CID | 15653 |
|---|---|
| CAS | 1758-88-9 |
| Molecular Weight (g/mol) | 134.222 |
| MDL Number | MFCD00059233 |
| SMILES | CCC1=C(C=CC(=C1)C)C |
| Synonym | 2-ethyl-p-xylene,1,4-dimethyl-2-ethylbenzene,benzene, 2-ethyl-1,4-dimethyl,2,5-dimethylethylbenzene,p-xylene, 2-ethyl,1-ethyl-2,5-dimethylbenzene,1,4-dimethyl-2-ethyl benzene,acmc-1c122,p-xylene, 2-ethyl-8ci |
| IUPAC Name | 2-ethyl-1,4-dimethylbenzene |
| InChI Key | AXIUBBVSOWPLDA-UHFFFAOYSA-N |
| Molecular Formula | C10H14 |
5-Ethyl-m-xylene 98.0+%, TCI America™
CAS: 934-74-7 Molecular Formula: C10H14 Molecular Weight (g/mol): 134.22 MDL Number: MFCD00059235 InChI Key: LMAUULKNZLEMGN-UHFFFAOYSA-N Synonym: 5-ethyl-m-xylene,1,3-dimethyl-5-ethylbenzene,m-xylene, 5-ethyl,benzene, 1-ethyl-3,5-dimethyl,5-ethyl-1,3-dimethylbenzene,benzene,5-dimethyl,3,5-dimethylethylbenzene,acmc-209rm2,1,3-dimethyl-5-ethyl benzene,1-ethyl-3,5-dimethyl-benzene PubChem CID: 13627 IUPAC Name: 1-ethyl-3,5-dimethylbenzene SMILES: CCC1=CC(C)=CC(C)=C1
| PubChem CID | 13627 |
|---|---|
| CAS | 934-74-7 |
| Molecular Weight (g/mol) | 134.22 |
| MDL Number | MFCD00059235 |
| SMILES | CCC1=CC(C)=CC(C)=C1 |
| Synonym | 5-ethyl-m-xylene,1,3-dimethyl-5-ethylbenzene,m-xylene, 5-ethyl,benzene, 1-ethyl-3,5-dimethyl,5-ethyl-1,3-dimethylbenzene,benzene,5-dimethyl,3,5-dimethylethylbenzene,acmc-209rm2,1,3-dimethyl-5-ethyl benzene,1-ethyl-3,5-dimethyl-benzene |
| IUPAC Name | 1-ethyl-3,5-dimethylbenzene |
| InChI Key | LMAUULKNZLEMGN-UHFFFAOYSA-N |
| Molecular Formula | C10H14 |
4-Bromo-2,6-dimethylaniline 98.0+%, TCI America™
CAS: 24596-19-8 Molecular Formula: C8H10BrN Molecular Weight (g/mol): 200.08 MDL Number: MFCD00007826 InChI Key: QGLAYJCJLHNIGJ-UHFFFAOYSA-N Synonym: 4-bromo-2,6-xylidine,benzenamine, 4-bromo-2,6-dimethyl,4-bromo-2,6-dimethyl-phenylamine,2-amino-5-bromo-m-xylene,2,6-dimethyl-4-bromoaniline,4-bromo-2,6-dimethylbenzenamine,4-bromo-2,6-dimethylphenylamine,4-bromo-2,6-dimethyl-aniline,4-bromo-2,6-dimethylaniline,4-bromo-2,6-dimethyl-benzenamine PubChem CID: 90549 IUPAC Name: 4-bromo-2,6-dimethylaniline SMILES: CC1=CC(Br)=CC(C)=C1N
| PubChem CID | 90549 |
|---|---|
| CAS | 24596-19-8 |
| Molecular Weight (g/mol) | 200.08 |
| MDL Number | MFCD00007826 |
| SMILES | CC1=CC(Br)=CC(C)=C1N |
| Synonym | 4-bromo-2,6-xylidine,benzenamine, 4-bromo-2,6-dimethyl,4-bromo-2,6-dimethyl-phenylamine,2-amino-5-bromo-m-xylene,2,6-dimethyl-4-bromoaniline,4-bromo-2,6-dimethylbenzenamine,4-bromo-2,6-dimethylphenylamine,4-bromo-2,6-dimethyl-aniline,4-bromo-2,6-dimethylaniline,4-bromo-2,6-dimethyl-benzenamine |
| IUPAC Name | 4-bromo-2,6-dimethylaniline |
| InChI Key | QGLAYJCJLHNIGJ-UHFFFAOYSA-N |
| Molecular Formula | C8H10BrN |
2,3-Dimethylbenzoic Acid 98.0+%, TCI America™
CAS: 603-79-2 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.177 MDL Number: MFCD00002479 InChI Key: RIZUCYSQUWMQLX-UHFFFAOYSA-N Synonym: hemellitic acid,benzoic acid, 2,3-dimethyl,2,3-dimethylbenzoicacid,2,3-dimethyl benzoic acid,2,3-dimethyl-benzoic acid,unii-7irp8ca267,2,3-dimethylbenzenecarboxylic acid,vic-o-xylylic acid,methyl m-toluic acid,pubchem2549 PubChem CID: 11782 ChEBI: CHEBI:64823 IUPAC Name: 2,3-dimethylbenzoic acid SMILES: CC1=CC=CC(=C1C)C(=O)O
| PubChem CID | 11782 |
|---|---|
| CAS | 603-79-2 |
| Molecular Weight (g/mol) | 150.177 |
| ChEBI | CHEBI:64823 |
| MDL Number | MFCD00002479 |
| SMILES | CC1=CC=CC(=C1C)C(=O)O |
| Synonym | hemellitic acid,benzoic acid, 2,3-dimethyl,2,3-dimethylbenzoicacid,2,3-dimethyl benzoic acid,2,3-dimethyl-benzoic acid,unii-7irp8ca267,2,3-dimethylbenzenecarboxylic acid,vic-o-xylylic acid,methyl m-toluic acid,pubchem2549 |
| IUPAC Name | 2,3-dimethylbenzoic acid |
| InChI Key | RIZUCYSQUWMQLX-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
alpha-Bromo-2-chlorophenylacetic Acid 98.0+%, TCI America™
CAS: 29270-30-2 Molecular Formula: C8H6BrClO2 Molecular Weight (g/mol): 249.488 MDL Number: MFCD03428513 InChI Key: XHAPROULWZYBGA-UHFFFAOYSA-N Synonym: alpha-bromo-2-chlorophenylacetic acid,2-bromo-2-2-chlorophenyl acetic acid,2-bromo-2-2'-chlorophenyl acetic acid,a-bromo 2-chlorophenylacetic acid,alpha-bromo-2-chlorophenyl acetic acid,alpha-bromo 2-chloro phenylacetic acid,bromo 2-chlorophenyl acetic acid,a-bromo-2-chlorophenylacetic acid,alapha-bromo-2-chloro-phenylacetic acid,benzeneacetic acid, alpha-bromo-2-chloro PubChem CID: 2774031 IUPAC Name: 2-bromo-2-(2-chlorophenyl)acetic acid SMILES: C1=CC=C(C(=C1)C(C(=O)O)Br)Cl
| PubChem CID | 2774031 |
|---|---|
| CAS | 29270-30-2 |
| Molecular Weight (g/mol) | 249.488 |
| MDL Number | MFCD03428513 |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)Br)Cl |
| Synonym | alpha-bromo-2-chlorophenylacetic acid,2-bromo-2-2-chlorophenyl acetic acid,2-bromo-2-2'-chlorophenyl acetic acid,a-bromo 2-chlorophenylacetic acid,alpha-bromo-2-chlorophenyl acetic acid,alpha-bromo 2-chloro phenylacetic acid,bromo 2-chlorophenyl acetic acid,a-bromo-2-chlorophenylacetic acid,alapha-bromo-2-chloro-phenylacetic acid,benzeneacetic acid, alpha-bromo-2-chloro |
| IUPAC Name | 2-bromo-2-(2-chlorophenyl)acetic acid |
| InChI Key | XHAPROULWZYBGA-UHFFFAOYSA-N |
| Molecular Formula | C8H6BrClO2 |